CAS 2223043-11-4 is the registry number for 2-Ethoxy-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-ethoxy-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 2223043-11-4) is a chemical compound with the molecular formula C12H20BNO3S and a molecular weight of 269.17 g/mol. IUPAC name: 2-ethoxy-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: NQIDRCYSJWDPFW-UHFFFAOYSA-N.
| Molecular formula | C12H20BNO3S |
|---|---|
| Molecular weight | 269.17 g/mol |
| IUPAC name | 2-ethoxy-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | NQIDRCYSJWDPFW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=C(S2)OCC)C |
Computed by PubChem (NCBI)