Products 1352317-78-2
CAS 1352317-78-2 is the registry number for 3-(4-Chloro-2-methoxyphenyl)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(4-chloro-2-methoxyphenyl)benzonitrile (CAS 1352317-78-2) is a chemical compound with the molecular formula C14H10ClNO and a molecular weight of 243.69 g/mol. IUPAC name: 3-(4-chloro-2-methoxyphenyl)benzonitrile. InChIKey: XURVKMUZOQWBPD-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 3-(4-chloro-2-methoxyphenyl)benzonitrile |
| InChIKey | XURVKMUZOQWBPD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)