CAS 42196-67-8 is the registry number for 2-(3-Chloro-4-methylphenyl)benzo[d]oxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chloro-4-methylphenyl)-1,3-benzoxazole (CAS 42196-67-8) is a chemical compound with the molecular formula C14H10ClNO and a molecular weight of 243.69 g/mol. IUPAC name: 2-(3-chloro-4-methylphenyl)-1,3-benzoxazole. InChIKey: XRUXDHOCEXKNMT-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 2-(3-chloro-4-methylphenyl)-1,3-benzoxazole |
| InChIKey | XRUXDHOCEXKNMT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NC3=CC=CC=C3O2)Cl |
Computed by PubChem (NCBI)