CAS 1352318-50-3 is the registry number for 4-Bromo-4'-(cyclopentyloxy)biphenyl, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
1-bromo-4-(4-cyclopentyloxyphenyl)benzene (CAS 1352318-50-3) is a chemical compound with the molecular formula C17H17BrO and a molecular weight of 317.2 g/mol. IUPAC name: 1-bromo-4-(4-cyclopentyloxyphenyl)benzene. InChIKey: RENFKMUZOLKPSW-UHFFFAOYSA-N.
| Molecular formula | C17H17BrO |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | 1-bromo-4-(4-cyclopentyloxyphenyl)benzene |
| InChIKey | RENFKMUZOLKPSW-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=CC=C(C=C2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)