CAS 91404-26-1 appears in our catalog under these names: 4-Bromo-4'-tert-butylbenzophenone, 97%, (4-Bromophenyl)(4-(tert-butyl)phenyl)methanone, 95+%. Offered by: Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g.
(4-bromophenyl)-(4-tert-butylphenyl)methanone (CAS 91404-26-1) is a chemical compound with the molecular formula C17H17BrO and a molecular weight of 317.2 g/mol. IUPAC name: (4-bromophenyl)-(4-tert-butylphenyl)methanone. InChIKey: YBWSLOFBLDMJLV-UHFFFAOYSA-N.
| Molecular formula | C17H17BrO |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | (4-bromophenyl)-(4-tert-butylphenyl)methanone |
| InChIKey | YBWSLOFBLDMJLV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)