CAS 1352491-80-5 appears in our catalog under these names: 6-Chloro-4,4-dimethylthiochroman, 95%, 6-Chloro-4,4-dimethylthiochroman. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-chloro-4,4-dimethyl-2,3-dihydrothiochromene (CAS 1352491-80-5) is a chemical compound with the molecular formula C11H13ClS and a molecular weight of 212.74 g/mol. IUPAC name: 6-chloro-4,4-dimethyl-2,3-dihydrothiochromene. InChIKey: OOINUIHPTRTFAE-UHFFFAOYSA-N.
| Molecular formula | C11H13ClS |
|---|---|
| Molecular weight | 212.74 g/mol |
| IUPAC name | 6-chloro-4,4-dimethyl-2,3-dihydrothiochromene |
| InChIKey | OOINUIHPTRTFAE-UHFFFAOYSA-N |
| SMILES | CC1(CCSC2=C1C=C(C=C2)Cl)C |
Computed by PubChem (NCBI)