CAS 64474-33-5 is the registry number for [(1-Chloro-2,3-dimethylcyclopropyl)thio]benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
(1-chloro-2,3-dimethylcyclopropyl)sulfanylbenzene (CAS 64474-33-5) is a chemical compound with the molecular formula C11H13ClS and a molecular weight of 212.74 g/mol. IUPAC name: (1-chloro-2,3-dimethylcyclopropyl)sulfanylbenzene. InChIKey: GJNDPBXIKNJNPJ-UHFFFAOYSA-N.
| Molecular formula | C11H13ClS |
|---|---|
| Molecular weight | 212.74 g/mol |
| IUPAC name | (1-chloro-2,3-dimethylcyclopropyl)sulfanylbenzene |
| InChIKey | GJNDPBXIKNJNPJ-UHFFFAOYSA-N |
| SMILES | CC1C(C1(SC2=CC=CC=C2)Cl)C |
Computed by PubChem (NCBI)