CAS 135266-23-8 is the registry number for SULFONYL AMIDE, POLYMER-SUPPORTED, 1% &. Offered by: Sigma-Aldrich. Available pack sizes: 5G.
Benzenesulfonamide;1,4-bis(ethenyl)benzene;styrene (CAS 135266-23-8) is a chemical compound with the molecular formula C24H25NO2S and a molecular weight of 391.5 g/mol. IUPAC name: benzenesulfonamide;1,4-bis(ethenyl)benzene;styrene. InChIKey: MUUSWFAQENVFGH-UHFFFAOYSA-N.
| Molecular formula | C24H25NO2S |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | benzenesulfonamide;1,4-bis(ethenyl)benzene;styrene |
| InChIKey | MUUSWFAQENVFGH-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=CC=C1.C=CC1=CC=C(C=C1)C=C.C1=CC=C(C=C1)S(=O)(=O)N |
Computed by PubChem (NCBI)