Products 1352718-50-3
CAS 1352718-50-3 is the registry number for 1-Bromo-2-(chloromethyl)-3-fluoro-4-(trifluoromethyl)benzene, 96%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
1-bromo-2-(chloromethyl)-3-fluoro-4-(trifluoromethyl)benzene (CAS 1352718-50-3) is a chemical compound with the molecular formula C8H4BrClF4 and a molecular weight of 291.47 g/mol. IUPAC name: 1-bromo-2-(chloromethyl)-3-fluoro-4-(trifluoromethyl)benzene. InChIKey: ZFIQEQSEQZDCPL-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClF4 |
|---|---|
| Molecular weight | 291.47 g/mol |
| IUPAC name | 1-bromo-2-(chloromethyl)-3-fluoro-4-(trifluoromethyl)benzene |
| InChIKey | ZFIQEQSEQZDCPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)F)CCl)Br |
Computed by PubChem (NCBI)