Products 1431329-80-4
CAS 1431329-80-4 appears in our catalog under these names: 4-Chloro-3-fluoro-5-(trifluoromethyl)benzyl bromide, 95%, 5-(Bromomethyl)-2-chloro-1-fluoro-3-(trifluoromethyl)benzene, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
5-(bromomethyl)-2-chloro-1-fluoro-3-(trifluoromethyl)benzene (CAS 1431329-80-4) is a chemical compound with the molecular formula C8H4BrClF4 and a molecular weight of 291.47 g/mol. IUPAC name: 5-(bromomethyl)-2-chloro-1-fluoro-3-(trifluoromethyl)benzene. InChIKey: BGRNEPFKNADEQJ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClF4 |
|---|---|
| Molecular weight | 291.47 g/mol |
| IUPAC name | 5-(bromomethyl)-2-chloro-1-fluoro-3-(trifluoromethyl)benzene |
| InChIKey | BGRNEPFKNADEQJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)F)CBr |
Computed by PubChem (NCBI)