Products 1352723-59-1

CAS 1352723-59-1 is the registry number for 2-Methyl-4-amino-5,6,7,8-tetrahydro-quinolin-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 4-amino-2-methyl-5,6,7,8-tetrahydroquinoline-3-carboxylate (CAS 1352723-59-1) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: ethyl 4-amino-2-methyl-5,6,7,8-tetrahydroquinoline-3-carboxylate. InChIKey: HTLWCZMROGTGHD-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18N2O2
Molecular weight234.29 g/mol
IUPAC nameethyl 4-amino-2-methyl-5,6,7,8-tetrahydroquinoline-3-carboxylate
InChIKeyHTLWCZMROGTGHD-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N=C2CCCCC2=C1N)C

Computed by PubChem (NCBI)