Products 1352887-69-4

CAS 1352887-69-4 is the registry number for Methyl 4-chloro-2,5-dimethylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 4-chloro-2,5-dimethylbenzoate (CAS 1352887-69-4) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: methyl 4-chloro-2,5-dimethylbenzoate. InChIKey: ZMLBCPHSVDZSRM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClO2
Molecular weight198.64 g/mol
IUPAC namemethyl 4-chloro-2,5-dimethylbenzoate
InChIKeyZMLBCPHSVDZSRM-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1Cl)C)C(=O)OC

Computed by PubChem (NCBI)