CAS 1352887-69-4 is the registry number for Methyl 4-chloro-2,5-dimethylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
Methyl 4-chloro-2,5-dimethylbenzoate (CAS 1352887-69-4) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: methyl 4-chloro-2,5-dimethylbenzoate. InChIKey: ZMLBCPHSVDZSRM-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | methyl 4-chloro-2,5-dimethylbenzoate |
| InChIKey | ZMLBCPHSVDZSRM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)C)C(=O)OC |
Computed by PubChem (NCBI)