CAS 1352925-64-4 appears in our catalog under these names: 1-Benzyl-4-bromo-3-methyl-1h-pyrazole-5-carbonitrile, 95%, 1-Benzyl-4-bromo-3-methyl-1H-pyrazole-5-carbonitrile, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
1-benzyl-4-bromo-3-methylpyrazole-5-carbonitrile (CAS 1352925-64-4) is a chemical compound with the molecular formula C12H10BrN3 and a molecular weight of 276.13 g/mol. IUPAC name: 1-benzyl-4-bromo-3-methylpyrazole-5-carbonitrile. InChIKey: NRTCMOCVKZLIBI-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN3 |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | 1-benzyl-4-bromo-3-methylpyrazole-5-carbonitrile |
| InChIKey | NRTCMOCVKZLIBI-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1Br)C#N)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)