CAS 1934302-87-0 is the registry number for 8-Bromo-6,11-dihydro-5H-benzo[b]pyrido[2,3-e][1,4]diazepine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-6,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepine (CAS 1934302-87-0) is a chemical compound with the molecular formula C12H10BrN3 and a molecular weight of 276.13 g/mol. IUPAC name: 8-bromo-6,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepine. InChIKey: PWMXAJGXKNTFMF-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN3 |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | 8-bromo-6,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepine |
| InChIKey | PWMXAJGXKNTFMF-UHFFFAOYSA-N |
| SMILES | C1C2=C(NC3=C(N1)C=C(C=C3)Br)N=CC=C2 |
Computed by PubChem (NCBI)