CAS 1353001-72-5 is the registry number for 3-Fluoro-5-(trifluoromethoxy)cinnamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(E)-3-[3-fluoro-5-(trifluoromethoxy)phenyl]prop-2-enoic acid (CAS 1353001-72-5) is a chemical compound with the molecular formula C10H6F4O3 and a molecular weight of 250.15 g/mol. IUPAC name: (E)-3-[3-fluoro-5-(trifluoromethoxy)phenyl]prop-2-enoic acid. InChIKey: KCORPQZTOLVNPS-OWOJBTEDSA-N.
| Molecular formula | C10H6F4O3 |
|---|---|
| Molecular weight | 250.15 g/mol |
| IUPAC name | (E)-3-[3-fluoro-5-(trifluoromethoxy)phenyl]prop-2-enoic acid |
| InChIKey | KCORPQZTOLVNPS-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)