CAS 540738-37-2 is the registry number for 6-Acetyl-2,2,3,3-tetrafluorobenzo-1,4-dioxene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)ethanone (CAS 540738-37-2) is a chemical compound with the molecular formula C10H6F4O3 and a molecular weight of 250.15 g/mol. IUPAC name: 1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)ethanone. InChIKey: XCSRDHYEONHVMI-UHFFFAOYSA-N.
| Molecular formula | C10H6F4O3 |
|---|---|
| Molecular weight | 250.15 g/mol |
| IUPAC name | 1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)ethanone |
| InChIKey | XCSRDHYEONHVMI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)OC(C(O2)(F)F)(F)F |
Computed by PubChem (NCBI)