Products 1353101-04-8

CAS 1353101-04-8 is the registry number for 3-Bromo-4,6-dichloropyridazine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

3-bromo-4,6-dichloropyridazine (CAS 1353101-04-8) is a chemical compound with the molecular formula C4HBrCl2N2 and a molecular weight of 227.87 g/mol. IUPAC name: 3-bromo-4,6-dichloropyridazine. InChIKey: CVIKSCBQUQGXBT-UHFFFAOYSA-N.

Identity
Molecular formulaC4HBrCl2N2
Molecular weight227.87 g/mol
IUPAC name3-bromo-4,6-dichloropyridazine
InChIKeyCVIKSCBQUQGXBT-UHFFFAOYSA-N
SMILESC1=C(C(=NN=C1Cl)Br)Cl

Computed by PubChem (NCBI)