Products 1402672-69-8

CAS 1402672-69-8 is the registry number for 3-Bromo-2,5-dichloropyrazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

3-bromo-2,5-dichloropyrazine (CAS 1402672-69-8) is a chemical compound with the molecular formula C4HBrCl2N2 and a molecular weight of 227.87 g/mol. IUPAC name: 3-bromo-2,5-dichloropyrazine. InChIKey: GDSIDODSAUTPKP-UHFFFAOYSA-N.

Identity
Molecular formulaC4HBrCl2N2
Molecular weight227.87 g/mol
IUPAC name3-bromo-2,5-dichloropyrazine
InChIKeyGDSIDODSAUTPKP-UHFFFAOYSA-N
SMILESC1=C(N=C(C(=N1)Cl)Br)Cl

Computed by PubChem (NCBI)