CAS 1353101-99-1 is the registry number for Methyl 2,6-dichloro-5-fluoropyrimidine-4-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 250mg.
Methyl 2,6-dichloro-5-fluoropyrimidine-4-carboxylate (CAS 1353101-99-1) is a chemical compound with the molecular formula C6H3Cl2FN2O2 and a molecular weight of 225.00 g/mol. IUPAC name: methyl 2,6-dichloro-5-fluoropyrimidine-4-carboxylate. InChIKey: DQJOBBWEMAVHSW-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2FN2O2 |
|---|---|
| Molecular weight | 225.00 g/mol |
| IUPAC name | methyl 2,6-dichloro-5-fluoropyrimidine-4-carboxylate |
| InChIKey | DQJOBBWEMAVHSW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NC(=N1)Cl)Cl)F |
Computed by PubChem (NCBI)