Products 1353101-99-1

CAS 1353101-99-1 is the registry number for Methyl 2,6-dichloro-5-fluoropyrimidine-4-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 250mg.

Methyl 2,6-dichloro-5-fluoropyrimidine-4-carboxylate (CAS 1353101-99-1) is a chemical compound with the molecular formula C6H3Cl2FN2O2 and a molecular weight of 225.00 g/mol. IUPAC name: methyl 2,6-dichloro-5-fluoropyrimidine-4-carboxylate. InChIKey: DQJOBBWEMAVHSW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Cl2FN2O2
Molecular weight225.00 g/mol
IUPAC namemethyl 2,6-dichloro-5-fluoropyrimidine-4-carboxylate
InChIKeyDQJOBBWEMAVHSW-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=NC(=N1)Cl)Cl)F

Computed by PubChem (NCBI)