CAS 2763157-87-3 is the registry number for 4-Amino-2,6-dichloro-5-fluoronicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-2,6-dichloro-5-fluoropyridine-3-carboxylic acid (CAS 2763157-87-3) is a chemical compound with the molecular formula C6H3Cl2FN2O2 and a molecular weight of 225.00 g/mol. IUPAC name: 4-amino-2,6-dichloro-5-fluoropyridine-3-carboxylic acid. InChIKey: YITKOJAYEYQWBY-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2FN2O2 |
|---|---|
| Molecular weight | 225.00 g/mol |
| IUPAC name | 4-amino-2,6-dichloro-5-fluoropyridine-3-carboxylic acid |
| InChIKey | YITKOJAYEYQWBY-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(N=C1Cl)Cl)F)N)C(=O)O |
Computed by PubChem (NCBI)