Products 2763157-87-3

CAS 2763157-87-3 is the registry number for 4-Amino-2,6-dichloro-5-fluoronicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-amino-2,6-dichloro-5-fluoropyridine-3-carboxylic acid (CAS 2763157-87-3) is a chemical compound with the molecular formula C6H3Cl2FN2O2 and a molecular weight of 225.00 g/mol. IUPAC name: 4-amino-2,6-dichloro-5-fluoropyridine-3-carboxylic acid. InChIKey: YITKOJAYEYQWBY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Cl2FN2O2
Molecular weight225.00 g/mol
IUPAC name4-amino-2,6-dichloro-5-fluoropyridine-3-carboxylic acid
InChIKeyYITKOJAYEYQWBY-UHFFFAOYSA-N
SMILESC1(=C(C(=C(N=C1Cl)Cl)F)N)C(=O)O

Computed by PubChem (NCBI)