Products 13533-17-0
CAS 13533-17-0 is the registry number for 4-Diazo-N,N-dimethylaniline chloride zinc chloride double salt, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(dimethylamino)benzenediazonium chloride (CAS 13533-17-0) is a chemical compound with the molecular formula C8H10ClN3 and a molecular weight of 183.64 g/mol. IUPAC name: 4-(dimethylamino)benzenediazonium chloride. InChIKey: CCIAVEMREXZXAK-UHFFFAOYSA-M.
| Molecular formula | C8H10ClN3 |
|---|---|
| Molecular weight | 183.64 g/mol |
| IUPAC name | 4-(dimethylamino)benzenediazonium chloride |
| InChIKey | CCIAVEMREXZXAK-UHFFFAOYSA-M |
| SMILES | CN(C)C1=CC=C(C=C1)[N+]#N.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
Benzenediazonium, 4-(dimethylamino)-, chloride, 4-(N,N-Dimethylamino)benzenediazonium chloride, 4-(dimethylamino)benzenediazonium;chloride, 4-dimethylaminobenzenediazonium chloride, 4-(dimethylamino)benzenediazonium chloride, 4-(dimethylamino)benzene-1-diazonium chloride, CCIAVEMREXZXAK-UHFFFAOYSA-M, p-(Dimethylamino)benzenediazonium chloride