CAS 135340-85-1 is the registry number for N,2,6-Trimethyl-N-phenylbenzamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
N,2,6-trimethyl-N-phenylbenzamide (CAS 135340-85-1) is a chemical compound with the molecular formula C16H17NO and a molecular weight of 239.31 g/mol. IUPAC name: N,2,6-trimethyl-N-phenylbenzamide. InChIKey: RKZOMLJNDJHKAS-UHFFFAOYSA-N.
| Molecular formula | C16H17NO |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | N,2,6-trimethyl-N-phenylbenzamide |
| InChIKey | RKZOMLJNDJHKAS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C(=O)N(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)