CAS 13535-93-8 is the registry number for L-Kynurenine sulfate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
(2S)-2-amino-4-(2-aminophenyl)-4-oxobutanoic acid;sulfuric acid (CAS 13535-93-8) is a chemical compound with the molecular formula C10H14N2O7S and a molecular weight of 306.29 g/mol. IUPAC name: (2S)-2-amino-4-(2-aminophenyl)-4-oxobutanoic acid;sulfuric acid. InChIKey: KAXRWMOLNJZCEW-QRPNPIFTSA-N.
| Molecular formula | C10H14N2O7S |
|---|---|
| Molecular weight | 306.29 g/mol |
| IUPAC name | (2S)-2-amino-4-(2-aminophenyl)-4-oxobutanoic acid;sulfuric acid |
| InChIKey | KAXRWMOLNJZCEW-QRPNPIFTSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C[C@@H](C(=O)O)N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)