Products 2126-91-2
CAS 2126-91-2 appears in our catalog under these names: 2-AMINO-4-(2-AMINOPHENYL)-4-OXOBUTANOIC ACID COMPOUND WITH SULFURIC ACID (1:1), 95%, 2-Amino-4-(2-aminophenyl)-4-oxobutanoic acid compound with sulfuric acid (1:1), 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-amino-4-(2-aminophenyl)-4-oxobutanoic acid;sulfuric acid (CAS 2126-91-2) is a chemical compound with the molecular formula C10H14N2O7S and a molecular weight of 306.29 g/mol. IUPAC name: 2-amino-4-(2-aminophenyl)-4-oxobutanoic acid;sulfuric acid. InChIKey: KAXRWMOLNJZCEW-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O7S |
|---|---|
| Molecular weight | 306.29 g/mol |
| IUPAC name | 2-amino-4-(2-aminophenyl)-4-oxobutanoic acid;sulfuric acid |
| InChIKey | KAXRWMOLNJZCEW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CC(C(=O)O)N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
DL-KYNURENINE SULFATE, DL-Kynurenine sulfate salt, Kynurenine sulfate, DL-, 2-amino-4-(2-aminophenyl)-4-oxobutanoic acid;sulfuric acid, 2-Amino-4-(2-aminophenyl)-4-oxobutanoic acid sulfuric acid salt, (2S)-2-amino-4-(2-aminophenyl)-4-oxobutanoic acid;sulfuric acid, DL-Kynurenine sulfate (salt) monohydrate, (R)-2-Amino-4-(2-aminophenyl)-4-oxobutanoic acid compound with sulfuric acid, DL-Kynureninesulfate, (R)-2-Amino-4-(2-aminophenyl)-4-oxobutanoic acid sulfuric acid salt