CAS 135357-90-3 is the registry number for (S)-2-(Benzylamino)-2-phenylethan-1-ol, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
(2S)-2-(benzylamino)-2-phenylethanol (CAS 135357-90-3) is a chemical compound with the molecular formula C15H17NO and a molecular weight of 227.30 g/mol. IUPAC name: (2S)-2-(benzylamino)-2-phenylethanol. InChIKey: FTFBWZQHBTVPEO-OAHLLOKOSA-N.
| Molecular formula | C15H17NO |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | (2S)-2-(benzylamino)-2-phenylethanol |
| InChIKey | FTFBWZQHBTVPEO-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)CN[C@H](CO)C2=CC=CC=C2 |
Computed by PubChem (NCBI)