CAS 1213022-14-0 is the registry number for (R)-2-Amino-1,2-diphenyl-1-propanol, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(2R)-2-amino-1,2-diphenylpropan-1-ol (CAS 1213022-14-0) is a chemical compound with the molecular formula C15H17NO and a molecular weight of 227.30 g/mol. IUPAC name: (2R)-2-amino-1,2-diphenylpropan-1-ol. InChIKey: ZGULRCHLTOMBNJ-YSSOQSIOSA-N.
| Molecular formula | C15H17NO |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | (2R)-2-amino-1,2-diphenylpropan-1-ol |
| InChIKey | ZGULRCHLTOMBNJ-YSSOQSIOSA-N |
| SMILES | C[C@@](C1=CC=CC=C1)(C(C2=CC=CC=C2)O)N |
Computed by PubChem (NCBI)