CAS 20616-52-8 is the registry number for (1R*,2S*)-2-(Methylamino)-1,2-diphenylethan-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
(1R,2S)-2-(methylamino)-1,2-diphenylethanol (CAS 20616-52-8) is a chemical compound with the molecular formula C15H17NO and a molecular weight of 227.30 g/mol. IUPAC name: (1R,2S)-2-(methylamino)-1,2-diphenylethanol. InChIKey: BLDFSDCBQJUWFG-LSDHHAIUSA-N.
| Molecular formula | C15H17NO |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | (1R,2S)-2-(methylamino)-1,2-diphenylethanol |
| InChIKey | BLDFSDCBQJUWFG-LSDHHAIUSA-N |
| SMILES | CN[C@@H](C1=CC=CC=C1)[C@@H](C2=CC=CC=C2)O |
Computed by PubChem (NCBI)