Products 1353854-09-7
CAS 1353854-09-7 is the registry number for 4-Bromo-1-(m-tolyl)-1H-imidazole, 96%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-1-(3-methylphenyl)imidazole (CAS 1353854-09-7) is a chemical compound with the molecular formula C10H9BrN2 and a molecular weight of 237.10 g/mol. IUPAC name: 4-bromo-1-(3-methylphenyl)imidazole. InChIKey: FLTYGHAFXGDJIV-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2 |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 4-bromo-1-(3-methylphenyl)imidazole |
| InChIKey | FLTYGHAFXGDJIV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C=C(N=C2)Br |
Computed by PubChem (NCBI)