CAS 1353941-01-1 is the registry number for N-Desmethyl-O-Methyl-Tapentadol. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R)-3-(3-methoxyphenyl)-N,2-dimethylpentan-1-amine (CAS 1353941-01-1) is a chemical compound with the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. IUPAC name: (2R,3R)-3-(3-methoxyphenyl)-N,2-dimethylpentan-1-amine. InChIKey: BJHIVDUGNUZYGO-SMDDNHRTSA-N.
| Molecular formula | C14H23NO |
|---|---|
| Molecular weight | 221.34 g/mol |
| IUPAC name | (2R,3R)-3-(3-methoxyphenyl)-N,2-dimethylpentan-1-amine |
| InChIKey | BJHIVDUGNUZYGO-SMDDNHRTSA-N |
| SMILES | CC[C@@H](C1=CC(=CC=C1)OC)[C@@H](C)CNC |
Computed by PubChem (NCBI)