Products 1353963-31-1
CAS 1353963-31-1 appears in our catalog under these names: Pyridine-2-sulfonic acid (pyrrolidin-2-ylmethyl)-amide hydrochloride, 95%, N-(Pyrrolidin-2-ylmethyl)pyridine-2-sulfonamide hydrochloride, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
N-(pyrrolidin-2-ylmethyl)pyridine-2-sulfonamide;hydrochloride (CAS 1353963-31-1) is a chemical compound with the molecular formula C10H16ClN3O2S and a molecular weight of 277.77 g/mol. IUPAC name: N-(pyrrolidin-2-ylmethyl)pyridine-2-sulfonamide;hydrochloride. InChIKey: SSNPTZDYTCRAOT-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN3O2S |
|---|---|
| Molecular weight | 277.77 g/mol |
| IUPAC name | N-(pyrrolidin-2-ylmethyl)pyridine-2-sulfonamide;hydrochloride |
| InChIKey | SSNPTZDYTCRAOT-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)CNS(=O)(=O)C2=CC=CC=N2.Cl |
Computed by PubChem (NCBI)