CAS 1592028-17-5 is the registry number for 1-(Pyridin-3-ylsulfonyl)-1,4-diazepane hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-pyridin-3-ylsulfonyl-1,4-diazepane;hydrochloride (CAS 1592028-17-5) is a chemical compound with the molecular formula C10H16ClN3O2S and a molecular weight of 277.77 g/mol. IUPAC name: 1-pyridin-3-ylsulfonyl-1,4-diazepane;hydrochloride. InChIKey: ICIAJIFVYJXJTH-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN3O2S |
|---|---|
| Molecular weight | 277.77 g/mol |
| IUPAC name | 1-pyridin-3-ylsulfonyl-1,4-diazepane;hydrochloride |
| InChIKey | ICIAJIFVYJXJTH-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)S(=O)(=O)C2=CN=CC=C2.Cl |
Computed by PubChem (NCBI)