CAS 1353978-50-3 appears in our catalog under these names: 1-((3-Bromophenyl)sulfonyl)-N-methylpiperidin-4-amine hydrochloride, 95%, 95%, [1-(3-Bromo-benzenesulfonyl)-piperidin-4-yl]-methyl-amine hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
1-(3-bromophenyl)sulfonyl-N-methylpiperidin-4-amine;hydrochloride (CAS 1353978-50-3) is a chemical compound with the molecular formula C12H18BrClN2O2S and a molecular weight of 369.71 g/mol. IUPAC name: 1-(3-bromophenyl)sulfonyl-N-methylpiperidin-4-amine;hydrochloride. InChIKey: SIRHIGDWLMRYCI-UHFFFAOYSA-N.
| Molecular formula | C12H18BrClN2O2S |
|---|---|
| Molecular weight | 369.71 g/mol |
| IUPAC name | 1-(3-bromophenyl)sulfonyl-N-methylpiperidin-4-amine;hydrochloride |
| InChIKey | SIRHIGDWLMRYCI-UHFFFAOYSA-N |
| SMILES | CNC1CCN(CC1)S(=O)(=O)C2=CC(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)