CAS 864759-59-1 is the registry number for 1-((4-Bromo-2-ethylphenyl)sulfonyl)piperazine hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromo-2-ethylphenyl)sulfonylpiperazine;hydrochloride (CAS 864759-59-1) is a chemical compound with the molecular formula C12H18BrClN2O2S and a molecular weight of 369.71 g/mol. IUPAC name: 1-(4-bromo-2-ethylphenyl)sulfonylpiperazine;hydrochloride. InChIKey: MRMVLBHFNRBJHF-UHFFFAOYSA-N.
| Molecular formula | C12H18BrClN2O2S |
|---|---|
| Molecular weight | 369.71 g/mol |
| IUPAC name | 1-(4-bromo-2-ethylphenyl)sulfonylpiperazine;hydrochloride |
| InChIKey | MRMVLBHFNRBJHF-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)Br)S(=O)(=O)N2CCNCC2.Cl |
Computed by PubChem (NCBI)