Products 1353989-57-7

CAS 1353989-57-7 is the registry number for 4-(Isopropylamino-methyl)-piperidine-1-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl 4-[(propan-2-ylamino)methyl]piperidine-1-carboxylate (CAS 1353989-57-7) is a chemical compound with the molecular formula C17H26N2O2 and a molecular weight of 290.4 g/mol. IUPAC name: benzyl 4-[(propan-2-ylamino)methyl]piperidine-1-carboxylate. InChIKey: KOEDSYBATRLBBQ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H26N2O2
Molecular weight290.4 g/mol
IUPAC namebenzyl 4-[(propan-2-ylamino)methyl]piperidine-1-carboxylate
InChIKeyKOEDSYBATRLBBQ-UHFFFAOYSA-N
SMILESCC(C)NCC1CCN(CC1)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)