Products 169750-00-9
CAS 169750-00-9 is the registry number for (S)-tert-Butyl 1-benzylpyrrolidin-3-yl(methyl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl N-[(3S)-1-benzylpyrrolidin-3-yl]-N-methylcarbamate (CAS 169750-00-9) is a chemical compound with the molecular formula C17H26N2O2 and a molecular weight of 290.4 g/mol. IUPAC name: tert-butyl N-[(3S)-1-benzylpyrrolidin-3-yl]-N-methylcarbamate. InChIKey: CAAZPJWHENFKCC-HNNXBMFYSA-N.
| Molecular formula | C17H26N2O2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | tert-butyl N-[(3S)-1-benzylpyrrolidin-3-yl]-N-methylcarbamate |
| InChIKey | CAAZPJWHENFKCC-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@H]1CCN(C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)