CAS 1353995-46-6 is the registry number for (R)-1-((2,4-Dichlorophenyl)sulfonyl)pyrrolidin-3-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(3R)-1-(2,4-dichlorophenyl)sulfonylpyrrolidin-3-ol (CAS 1353995-46-6) is a chemical compound with the molecular formula C10H11Cl2NO3S and a molecular weight of 296.17 g/mol. IUPAC name: (3R)-1-(2,4-dichlorophenyl)sulfonylpyrrolidin-3-ol. InChIKey: ARBNZEUQGBOYNU-MRVPVSSYSA-N.
| Molecular formula | C10H11Cl2NO3S |
|---|---|
| Molecular weight | 296.17 g/mol |
| IUPAC name | (3R)-1-(2,4-dichlorophenyl)sulfonylpyrrolidin-3-ol |
| InChIKey | ARBNZEUQGBOYNU-MRVPVSSYSA-N |
| SMILES | C1CN(C[C@@H]1O)S(=O)(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)