CAS 311315-85-2 is the registry number for 4-((2,3-Dichlorophenyl)sulfonyl)morpholine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,3-dichlorophenyl)sulfonylmorpholine (CAS 311315-85-2) is a chemical compound with the molecular formula C10H11Cl2NO3S and a molecular weight of 296.17 g/mol. IUPAC name: 4-(2,3-dichlorophenyl)sulfonylmorpholine. InChIKey: XYUAEUXVKOCZJV-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO3S |
|---|---|
| Molecular weight | 296.17 g/mol |
| IUPAC name | 4-(2,3-dichlorophenyl)sulfonylmorpholine |
| InChIKey | XYUAEUXVKOCZJV-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)