Products 1354020-90-8
CAS 1354020-90-8 appears in our catalog under these names: (4-Methyl-benzyl)-(R)-pyrrolidin-3-yl-amine hydrochloride, 95%, (R)-N-(4-Methylbenzyl)pyrrolidin-3-amine hydrochloride, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
(3R)-N-[(4-methylphenyl)methyl]pyrrolidin-3-amine;hydrochloride (CAS 1354020-90-8) is a chemical compound with the molecular formula C12H19ClN2 and a molecular weight of 226.74 g/mol. IUPAC name: (3R)-N-[(4-methylphenyl)methyl]pyrrolidin-3-amine;hydrochloride. InChIKey: MOXMHTMAELLWEL-UTONKHPSSA-N.
| Molecular formula | C12H19ClN2 |
|---|---|
| Molecular weight | 226.74 g/mol |
| IUPAC name | (3R)-N-[(4-methylphenyl)methyl]pyrrolidin-3-amine;hydrochloride |
| InChIKey | MOXMHTMAELLWEL-UTONKHPSSA-N |
| SMILES | CC1=CC=C(C=C1)CN[C@@H]2CCNC2.Cl |
Computed by PubChem (NCBI)