CAS 13541-18-9 appears in our catalog under these names: 1-(4-Bromophenyl)-3,3,3-trifluoropropan-1-one, 95%, 1-(4-Bromophenyl)-3,3,3-trifluoropropan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(4-bromophenyl)-3,3,3-trifluoropropan-1-one (CAS 13541-18-9) is a chemical compound with the molecular formula C9H6BrF3O and a molecular weight of 267.04 g/mol. IUPAC name: 1-(4-bromophenyl)-3,3,3-trifluoropropan-1-one. InChIKey: ZIDCPZHLCKPYGO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O |
|---|---|
| Molecular weight | 267.04 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3,3,3-trifluoropropan-1-one |
| InChIKey | ZIDCPZHLCKPYGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(F)(F)F)Br |
Computed by PubChem (NCBI)