Products 135417-65-1
CAS 135417-65-1 appears in our catalog under these names: 1–Phenyl–1H–imidazole–5–carboxylic acid, 1-Phenyl-1H-imidazole-5-carboxylic acid, 1-Phenyl-1H-imidazole-5-carboxylic acid, 98%, 1-Phenyl-1H-imidazole-5-carboxylic acid, 97%, 97%, 1-Phenyl-1H-imidazole-5-carboxylic acid, 97%. Offered by: GLPBio, Biosynth, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 5g, 25g, 10g, 100mg.
3-phenylimidazole-4-carboxylic acid (CAS 135417-65-1) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 3-phenylimidazole-4-carboxylic acid. InChIKey: FSVMTMFHLLEQAS-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 3-phenylimidazole-4-carboxylic acid |
| InChIKey | FSVMTMFHLLEQAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NC=C2C(=O)O |
Computed by PubChem (NCBI)