CAS 1354488-29-1 is the registry number for Fmoc-S-carbamoyl-L-cysteine. Offered by: TRC. Available pack sizes: 250mg.
(2S)-3-carbamoylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1354488-29-1) is a chemical compound with the molecular formula C19H18N2O5S and a molecular weight of 386.4 g/mol. IUPAC name: (2S)-3-carbamoylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: IFPYYXWHARILPJ-MRXNPFEDSA-N.
| Molecular formula | C19H18N2O5S |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | (2S)-3-carbamoylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | IFPYYXWHARILPJ-MRXNPFEDSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CSC(=O)N)C(=O)O |
Computed by PubChem (NCBI)