Products 146062-48-8
CAS 146062-48-8 appears in our catalog under these names: Pioglitazone M5 Metabolite, Pioglitazone Impurity 19, Carboxy Pioglitazone (M-V), 6-(2-(4-((2,4-Dioxo-5-thiazolidinyl)methyl)phenoxy)ethyl)-3-pyridineacetic acid. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
2-[6-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-3-pyridinyl]acetic acid (CAS 146062-48-8) is a chemical compound with the molecular formula C19H18N2O5S and a molecular weight of 386.4 g/mol. IUPAC name: 2-[6-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-3-pyridinyl]acetic acid. InChIKey: OIQJTMMAMWFMQR-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O5S |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 2-[6-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-3-pyridinyl]acetic acid |
| InChIKey | OIQJTMMAMWFMQR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2C(=O)NC(=O)S2)OCCC3=NC=C(C=C3)CC(=O)O |
Computed by PubChem (NCBI)