Products 135449-70-6

CAS 135449-70-6 is the registry number for N-Cyclopropyl-succinamic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(cyclopropylamino)-4-oxobutanoic acid (CAS 135449-70-6) is a chemical compound with the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. IUPAC name: 4-(cyclopropylamino)-4-oxobutanoic acid. InChIKey: ASJRDGPSQDCCBU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11NO3
Molecular weight157.17 g/mol
IUPAC name4-(cyclopropylamino)-4-oxobutanoic acid
InChIKeyASJRDGPSQDCCBU-UHFFFAOYSA-N
SMILESC1CC1NC(=O)CCC(=O)O

Computed by PubChem (NCBI)