Products 1354546-42-1
CAS 1354546-42-1 appears in our catalog under these names: Antibacterial agent 171/ 99.54% (existing batch purity), (2S)-4-biphenyl-4-yl-N-hydroxy-2-methyl-2-(methylsulfonyl)butanamide. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(2S)-N-hydroxy-2-methyl-2-methylsulfonyl-4-(4-phenylphenyl)butanamide (CAS 1354546-42-1) is a chemical compound with the molecular formula C18H21NO4S and a molecular weight of 347.4 g/mol. IUPAC name: (2S)-N-hydroxy-2-methyl-2-methylsulfonyl-4-(4-phenylphenyl)butanamide. InChIKey: GDYIQUFNICPYHF-SFHVURJKSA-N.
| Molecular formula | C18H21NO4S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | (2S)-N-hydroxy-2-methyl-2-methylsulfonyl-4-(4-phenylphenyl)butanamide |
| InChIKey | GDYIQUFNICPYHF-SFHVURJKSA-N |
| SMILES | C[C@](CCC1=CC=C(C=C1)C2=CC=CC=C2)(C(=O)NO)S(=O)(=O)C |
Computed by PubChem (NCBI)