CAS 1354550-11-0 is the registry number for 5'-(4-Carboxyphenyl)-2'-methoxy-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[3,5-bis(4-carboxyphenyl)-4-methoxyphenyl]benzoic acid (CAS 1354550-11-0) is a chemical compound with the molecular formula C28H20O7 and a molecular weight of 468.5 g/mol. IUPAC name: 4-[3,5-bis(4-carboxyphenyl)-4-methoxyphenyl]benzoic acid. InChIKey: RFPWQQRSTPZYFX-UHFFFAOYSA-N.
| Molecular formula | C28H20O7 |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | 4-[3,5-bis(4-carboxyphenyl)-4-methoxyphenyl]benzoic acid |
| InChIKey | RFPWQQRSTPZYFX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1C2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)C(=O)O)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)