Products 1354550-11-0

CAS 1354550-11-0 is the registry number for 5'-(4-Carboxyphenyl)-2'-methoxy-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[3,5-bis(4-carboxyphenyl)-4-methoxyphenyl]benzoic acid (CAS 1354550-11-0) is a chemical compound with the molecular formula C28H20O7 and a molecular weight of 468.5 g/mol. IUPAC name: 4-[3,5-bis(4-carboxyphenyl)-4-methoxyphenyl]benzoic acid. InChIKey: RFPWQQRSTPZYFX-UHFFFAOYSA-N.

Identity
Molecular formulaC28H20O7
Molecular weight468.5 g/mol
IUPAC name4-[3,5-bis(4-carboxyphenyl)-4-methoxyphenyl]benzoic acid
InChIKeyRFPWQQRSTPZYFX-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1C2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)C(=O)O)C4=CC=C(C=C4)C(=O)O

Computed by PubChem (NCBI)