Products 206444-58-8
CAS 206444-58-8 appears in our catalog under these names: Fluorescein O,O`–dimethacrylate, FLUORESCEIN O,O'-DIMETHACRYLATE, 95%, FLUORESCEIN O O'-DIMETHACRYLATE 95, ≥95%, ≥95%. Offered by: GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 1g, 250mg, 25mg.
[6'-(2-methylprop-2-enoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2-methylprop-2-enoate (CAS 206444-58-8) is a chemical compound with the molecular formula C28H20O7 and a molecular weight of 468.5 g/mol. IUPAC name: [6'-(2-methylprop-2-enoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2-methylprop-2-enoate. InChIKey: IJMJZIOPZNRQMM-UHFFFAOYSA-N.
| Molecular formula | C28H20O7 |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | [6'-(2-methylprop-2-enoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2-methylprop-2-enoate |
| InChIKey | IJMJZIOPZNRQMM-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C(=C)C)C5=CC=CC=C5C(=O)O3 |
Computed by PubChem (NCBI)