CAS 1354764-81-0 is the registry number for 7-Amino-2-(4-chlorophenyl)[1,2,4]triazolo[1,5-a]pyrimidin-5(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-amino-2-(4-chlorophenyl)-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one (CAS 1354764-81-0) is a chemical compound with the molecular formula C11H8ClN5O and a molecular weight of 261.67 g/mol. IUPAC name: 7-amino-2-(4-chlorophenyl)-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one. InChIKey: HHEGPLQDCOLCQZ-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN5O |
|---|---|
| Molecular weight | 261.67 g/mol |
| IUPAC name | 7-amino-2-(4-chlorophenyl)-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
| InChIKey | HHEGPLQDCOLCQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN3C(=CC(=O)NC3=N2)N)Cl |
Computed by PubChem (NCBI)