CAS 1448694-38-9 is the registry number for 5-Chloro-3-(4-methoxy-phenyl)-3h-[1,2,3]triazolo[4,5-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-chloro-3-(4-methoxyphenyl)triazolo[4,5-d]pyrimidine (CAS 1448694-38-9) is a chemical compound with the molecular formula C11H8ClN5O and a molecular weight of 261.67 g/mol. IUPAC name: 5-chloro-3-(4-methoxyphenyl)triazolo[4,5-d]pyrimidine. InChIKey: IWTUSMBWCYJNMO-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN5O |
|---|---|
| Molecular weight | 261.67 g/mol |
| IUPAC name | 5-chloro-3-(4-methoxyphenyl)triazolo[4,5-d]pyrimidine |
| InChIKey | IWTUSMBWCYJNMO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C3=NC(=NC=C3N=N2)Cl |
Computed by PubChem (NCBI)