Products 1354783-58-6
CAS 1354783-58-6 appears in our catalog under these names: [4-(1H-Imidazol-1-yl)-3-(trifluoromethyl)phenyl]amine hydrochloride, 95%, [4-(1H-IMIDAZOL-1-YL)-3-(TRIFLUOROMETHYL)PHENYL]AMINE HYDROCHLORIDE, 96%, 96%, 4-(1H-Imidazol-1-yl)-3-(trifluoromethyl)aniline hydrochloride, 96%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
4-imidazol-1-yl-3-(trifluoromethyl)aniline;hydrochloride (CAS 1354783-58-6) is a chemical compound with the molecular formula C10H9ClF3N3 and a molecular weight of 263.65 g/mol. IUPAC name: 4-imidazol-1-yl-3-(trifluoromethyl)aniline;hydrochloride. InChIKey: QWIPSMBFAVJABG-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3N3 |
|---|---|
| Molecular weight | 263.65 g/mol |
| IUPAC name | 4-imidazol-1-yl-3-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | QWIPSMBFAVJABG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(F)(F)F)N2C=CN=C2.Cl |
Computed by PubChem (NCBI)