CAS 88164-54-9 appears in our catalog under these names: 4-Hydrazino 7-trifluoromethyl-quinoline hydrochloride, 95%, 4-Hydrazinyl-7-(trifluoromethyl)quinoline hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
[7-(trifluoromethyl)quinolin-4-yl]hydrazine;hydrochloride (CAS 88164-54-9) is a chemical compound with the molecular formula C10H9ClF3N3 and a molecular weight of 263.65 g/mol. IUPAC name: [7-(trifluoromethyl)quinolin-4-yl]hydrazine;hydrochloride. InChIKey: ZKBKPDSQOGAGCE-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3N3 |
|---|---|
| Molecular weight | 263.65 g/mol |
| IUPAC name | [7-(trifluoromethyl)quinolin-4-yl]hydrazine;hydrochloride |
| InChIKey | ZKBKPDSQOGAGCE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C=C1C(F)(F)F)NN.Cl |
Computed by PubChem (NCBI)